C10H16N2O3S — CID 100816223
(2R,5R)-2-methyl-5-(morpholine-4-carbonyl)thiomorpholin-3-one (PubChem CID 100816223) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is (2R,5R)-2-methyl-5-(morpholine-4-carbonyl)thiomorpholin-3-one.
| Compound Name | (2R,5R)-2-methyl-5-(morpholine-4-carbonyl)thiomorpholin-3-one |
|---|---|
| PubChem CID | 100816223 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (2R,5R)-2-methyl-5-(morpholine-4-carbonyl)thiomorpholin-3-one |
| SMILES | C[C@H]1SC[C@@H](C(=O)N2CCOCC2)NC1=O |
| InChI | InChI=1S/C10H16N2O3S/c1-7-9(13)11-8(6-16-7)10(14)12-2-4-15-5-3-12/h7-8H,2-6H2,1H3,(H,11,13)/t7-,8+/m1/s1 |
| InChIKey | GVLDDLGGWFTTEX-SFYZADRCSA-N |
| XLogP | -0.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |