C11H20N2O2 — CID 142300145
[(2S)-1,3-dimethylpyrrolidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 142300145) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is [(2S)-1,3-dimethylpyrrolidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S)-1,3-dimethylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 142300145 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [(2S)-1,3-dimethylpyrrolidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | CC1CCN(C)[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H20N2O2/c1-9-3-4-12(2)10(9)11(14)13-5-7-15-8-6-13/h9-10H,3-8H2,1-2H3/t9?,10-/m0/s1 |
| InChIKey | XBJVNXAYSMEYNS-AXDSSHIGSA-N |
| XLogP | 0.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |