C19H30N2O3 — CID 129430953
[(1R,6R)-6-[(3S,4R)-3,4-dimethylpiperidine-1-carbonyl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone (PubChem CID 129430953) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(1R,6R)-6-[(3S,4R)-3,4-dimethylpiperidine-1-carbonyl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [(1R,6R)-6-[(3S,4R)-3,4-dimethylpiperidine-1-carbonyl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 129430953 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | [(1R,6R)-6-[(3S,4R)-3,4-dimethylpiperidine-1-carbonyl]cyclohex-3-en-1-yl]-morpholin-4-ylmethanone |
| SMILES | C[C@@H]1CCN(C(=O)[C@@H]2CC=CC[C@H]2C(=O)N2CCOCC2)C[C@H]1C |
| InChI | InChI=1S/C19H30N2O3/c1-14-7-8-21(13-15(14)2)19(23)17-6-4-3-5-16(17)18(22)20-9-11-24-12-10-20/h3-4,14-17H,5-13H2,1-2H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | DISJHJRHRKLIAQ-QBPKDAKJSA-N |
| XLogP | 1.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|