C11H19NO — CID 21061776
cyclopropyl-(3,4-dimethylpiperidin-1-yl)methanone (PubChem CID 21061776) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is cyclopropyl-(3,4-dimethylpiperidin-1-yl)methanone.
| Compound Name | cyclopropyl-(3,4-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 21061776 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | cyclopropyl-(3,4-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)C2CC2)CC1C |
| InChI | InChI=1S/C11H19NO/c1-8-5-6-12(7-9(8)2)11(13)10-3-4-10/h8-10H,3-7H2,1-2H3 |
| InChIKey | BXEWWRQCMXSTIO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |