C9H13NO2 — CID 97181337
cyclopropyl-[(1R,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone (PubChem CID 97181337) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is cyclopropyl-[(1R,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone.
| Compound Name | cyclopropyl-[(1R,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone |
|---|---|
| PubChem CID | 97181337 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | cyclopropyl-[(1R,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone |
| SMILES | O=C(C1CC1)N1CC[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C9H13NO2/c11-9(6-1-2-6)10-4-3-7-8(5-10)12-7/h6-8H,1-5H2/t7-,8+/m0/s1 |
| InChIKey | AFQUGFZOWPOSBR-JGVFFNPUSA-N |
| XLogP | 0.40 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|