C14H20NO3- — CID 7333962
(1S,6R)-6-(4-methylpiperidine-1-carbonyl)cyclohex-3-ene-1-carboxylate (PubChem CID 7333962) has the molecular formula C14H20NO3- and a molecular weight of 250.32 g/mol. Its IUPAC name is (1S,6R)-6-(4-methylpiperidine-1-carbonyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-(4-methylpiperidine-1-carbonyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7333962 |
| Molecular Formula | C14H20NO3- |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (1S,6R)-6-(4-methylpiperidine-1-carbonyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CC1CCN(C(=O)[C@@H]2CC=CC[C@@H]2C(=O)[O-])CC1 |
| InChI | InChI=1S/C14H21NO3/c1-10-6-8-15(9-7-10)13(16)11-4-2-3-5-12(11)14(17)18/h2-3,10-12H,4-9H2,1H3,(H,17,18)/p-1/t11-,12+/m1/s1 |
| InChIKey | SQSJYSYQXWXIRV-NEPJUHHUSA-M |
| XLogP | 0.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|