C19H25N3O6S2 — CID 10527750
dimethyl (4R,13R)-2,15-dioxo-6,11-dithia-3,14,20-triazabicyclo[14.3.1]icosa-1(20),16,18-triene-4,13-dicarboxylate (PubChem CID 10527750) has the molecular formula C19H25N3O6S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is dimethyl (4R,13R)-2,15-dioxo-6,11-dithia-3,14,20-triazabicyclo[14.3.1]icosa-1(20),16,18-triene-4,13-dicarboxylate.
| Compound Name | dimethyl (4R,13R)-2,15-dioxo-6,11-dithia-3,14,20-triazabicyclo[14.3.1]icosa-1(20),16,18-triene-4,13-dicarboxylate |
|---|---|
| PubChem CID | 10527750 |
| Molecular Formula | C19H25N3O6S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | dimethyl (4R,13R)-2,15-dioxo-6,11-dithia-3,14,20-triazabicyclo[14.3.1]icosa-1(20),16,18-triene-4,13-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CSCCCCSC[C@@H](C(=O)OC)NC(=O)c2cccc(n2)C(=O)N1 |
| InChI | InChI=1S/C19H25N3O6S2/c1-27-18(25)14-10-29-8-3-4-9-30-11-15(19(26)28-2)22-17(24)13-7-5-6-12(20-13)16(23)21-14/h5-7,14-15H,3-4,8-11H2,1-2H3,(H,21,23)(H,22,24)/t14-,15-/m0/s1 |
| InChIKey | JJWVPZIJRJXPAC-GJZGRUSLSA-N |
| XLogP | 0.88 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |