C22H34ClN3O5S — CID 66846960
methyl (9R,12S,15S)-15-amino-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-triene-9-carboxylate;hydrochloride (PubChem CID 66846960) has the molecular formula C22H34ClN3O5S and a molecular weight of 488.05 g/mol. Its IUPAC name is methyl (9R,12S,15S)-15-amino-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-triene-9-carboxylate;hydrochloride.
| Compound Name | methyl (9R,12S,15S)-15-amino-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-triene-9-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 66846960 |
| Molecular Formula | C22H34ClN3O5S |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | methyl (9R,12S,15S)-15-amino-11,14-dioxo-12-propan-2-yl-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-triene-9-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1CSCCCCOc2ccc(cc2)C[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N1.Cl |
| InChI | InChI=1S/C22H33N3O5S.ClH/c1-14(2)19-21(27)24-18(22(28)29-3)13-31-11-5-4-10-30-16-8-6-15(7-9-16)12-17(23)20(26)25-19;/h6-9,14,17-19H,4-5,10-13,23H2,1-3H3,(H,24,27)(H,25,26);1H/t17-,18-,19-;/m0./s1 |
| InChIKey | IIRLZCHCZIQMKP-YOTVLOEGSA-N |
| XLogP | 1.68 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |