C22H25N3O6 — CID 102507420
(9S,12S,15S)-9-amino-12-[(1R)-1-hydroxyethyl]-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid (PubChem CID 102507420) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is (9S,12S,15S)-9-amino-12-[(1R)-1-hydroxyethyl]-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid.
| Compound Name | (9S,12S,15S)-9-amino-12-[(1R)-1-hydroxyethyl]-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid |
|---|---|
| PubChem CID | 102507420 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (9S,12S,15S)-9-amino-12-[(1R)-1-hydroxyethyl]-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid |
| SMILES | C[C@@H](O)[C@@H]1NC(=O)[C@@H](N)Cc2cccc(c2)Oc2ccc(cc2)C[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C22H25N3O6/c1-12(26)19-21(28)24-18(22(29)30)11-13-5-7-15(8-6-13)31-16-4-2-3-14(9-16)10-17(23)20(27)25-19/h2-9,12,17-19,26H,10-11,23H2,1H3,(H,24,28)(H,25,27)(H,29,30)/t12-,17+,18+,19+/m1/s1 |
| InChIKey | GYRTWIPDLYTFSG-JNPHEJMOSA-N |
| XLogP | 0.34 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |