C24H30N6O8 — CID 72808487
9-amino-12-[3-(diaminomethylideneamino)-1,2-dihydroxypropyl]-4-hydroxy-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid (PubChem CID 72808487) has the molecular formula C24H30N6O8 and a molecular weight of 530.54 g/mol. Its IUPAC name is 9-amino-12-[3-(diaminomethylideneamino)-1,2-dihydroxypropyl]-4-hydroxy-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid.
| Compound Name | 9-amino-12-[3-(diaminomethylideneamino)-1,2-dihydroxypropyl]-4-hydroxy-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid |
|---|---|
| PubChem CID | 72808487 |
| Molecular Formula | C24H30N6O8 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 9-amino-12-[3-(diaminomethylideneamino)-1,2-dihydroxypropyl]-4-hydroxy-10,13-dioxo-2-oxa-11,14-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-15-carboxylic acid |
| SMILES | NC(N)=NCC(O)C(O)C1NC(=O)C(N)Cc2ccc(O)c(c2)Oc2ccc(cc2)CC(C(=O)O)NC1=O |
| InChI | InChI=1S/C24H30N6O8/c25-14-7-12-3-6-16(31)18(9-12)38-13-4-1-11(2-5-13)8-15(23(36)37)29-22(35)19(30-21(14)34)20(33)17(32)10-28-24(26)27/h1-6,9,14-15,17,19-20,31-33H,7-8,10,25H2,(H,29,35)(H,30,34)(H,36,37)(H4,26,27,28) |
| InChIKey | WGXANKDMVJQLAR-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 255.84 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|