C24H29N3O7 — CID 101241264
(8S,11S,14S)-14-amino-11-[(2R)-butan-2-yl]-3,4,19-trihydroxy-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene-8-carboxylic acid (PubChem CID 101241264) has the molecular formula C24H29N3O7 and a molecular weight of 471.51 g/mol. Its IUPAC name is (8S,11S,14S)-14-amino-11-[(2R)-butan-2-yl]-3,4,19-trihydroxy-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene-8-carboxylic acid.
| Compound Name | (8S,11S,14S)-14-amino-11-[(2R)-butan-2-yl]-3,4,19-trihydroxy-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene-8-carboxylic acid |
|---|---|
| PubChem CID | 101241264 |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (8S,11S,14S)-14-amino-11-[(2R)-butan-2-yl]-3,4,19-trihydroxy-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(19),2,4,6(21),16(20),17-hexaene-8-carboxylic acid |
| SMILES | CC[C@@H](C)[C@@H]1NC(=O)[C@@H](N)Cc2ccc(O)c(c2)-c2cc(cc(O)c2O)C[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C24H29N3O7/c1-3-11(2)20-23(32)26-17(24(33)34)9-13-7-15(21(30)19(29)10-13)14-6-12(4-5-18(14)28)8-16(25)22(31)27-20/h4-7,10-11,16-17,20,28-30H,3,8-9,25H2,1-2H3,(H,26,32)(H,27,31)(H,33,34)/t11-,16+,17+,20+/m1/s1 |
| InChIKey | BTPVAZQOZQKXFS-NBSNSOTFSA-N |
| XLogP | 1.00 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|