C21H37N5O6S — CID 177419524
(3R,9S,12S,15S)-15-amino-12-[(2S)-butan-2-yl]-9-methyl-6-(2-methylpropyl)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid (PubChem CID 177419524) has the molecular formula C21H37N5O6S and a molecular weight of 487.62 g/mol. Its IUPAC name is (3R,9S,12S,15S)-15-amino-12-[(2S)-butan-2-yl]-9-methyl-6-(2-methylpropyl)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid.
| Compound Name | (3R,9S,12S,15S)-15-amino-12-[(2S)-butan-2-yl]-9-methyl-6-(2-methylpropyl)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid |
|---|---|
| PubChem CID | 177419524 |
| Molecular Formula | C21H37N5O6S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (3R,9S,12S,15S)-15-amino-12-[(2S)-butan-2-yl]-9-methyl-6-(2-methylpropyl)-5,8,11,14-tetraoxo-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](N)CSC[C@@H](C(=O)O)NC(=O)C(CC(C)C)NC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C21H37N5O6S/c1-6-11(4)16-20(30)23-12(5)17(27)24-14(7-10(2)3)19(29)25-15(21(31)32)9-33-8-13(22)18(28)26-16/h10-16H,6-9,22H2,1-5H3,(H,23,30)(H,24,27)(H,25,29)(H,26,28)(H,31,32)/t11-,12-,13+,14?,15-,16-/m0/s1 |
| InChIKey | WUZKJHHKCJMNLT-UEMDNKKBSA-N |
| XLogP | -0.80 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |