C27H41N5O5S2 — CID 177484158
(3R,12S,15S)-15-amino-9-benzyl-12-[(2S)-butan-2-yl]-6-(2-methylpropyl)-5,8,14-trioxo-11-sulfanylidene-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid (PubChem CID 177484158) has the molecular formula C27H41N5O5S2 and a molecular weight of 579.79 g/mol. Its IUPAC name is (3R,12S,15S)-15-amino-9-benzyl-12-[(2S)-butan-2-yl]-6-(2-methylpropyl)-5,8,14-trioxo-11-sulfanylidene-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid.
| Compound Name | (3R,12S,15S)-15-amino-9-benzyl-12-[(2S)-butan-2-yl]-6-(2-methylpropyl)-5,8,14-trioxo-11-sulfanylidene-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid |
|---|---|
| PubChem CID | 177484158 |
| Molecular Formula | C27H41N5O5S2 |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | (3R,12S,15S)-15-amino-9-benzyl-12-[(2S)-butan-2-yl]-6-(2-methylpropyl)-5,8,14-trioxo-11-sulfanylidene-1-thia-4,7,10,13-tetrazacyclohexadecane-3-carboxylic acid |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](N)CSC[C@@H](C(=O)O)NC(=O)C(CC(C)C)NC(=O)C(Cc2ccccc2)NC1=S |
| InChI | InChI=1S/C27H41N5O5S2/c1-5-16(4)22-26(38)31-20(12-17-9-7-6-8-10-17)25(35)29-19(11-15(2)3)24(34)30-21(27(36)37)14-39-13-18(28)23(33)32-22/h6-10,15-16,18-22H,5,11-14,28H2,1-4H3,(H,29,35)(H,30,34)(H,31,38)(H,32,33)(H,36,37)/t16-,18+,19?,20?,21-,22-/m0/s1 |
| InChIKey | SPIHGQNTFNVWGF-CNFNWNLXSA-N |
| XLogP | 1.22 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|