C28H33N3O6 — CID 15975425
(9S,12S,15R)-15-acetamido-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carboxylic acid (PubChem CID 15975425) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is (9S,12S,15R)-15-acetamido-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carboxylic acid.
| Compound Name | (9S,12S,15R)-15-acetamido-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carboxylic acid |
|---|---|
| PubChem CID | 15975425 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | (9S,12S,15R)-15-acetamido-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1Cc2ccc(cc2)Oc2cccc(c2)C[C@@H](C(=O)O)NC(=O)[C@H](C2CCCCC2)NC1=O |
| InChI | InChI=1S/C28H33N3O6/c1-17(32)29-23-15-18-10-12-21(13-11-18)37-22-9-5-6-19(14-22)16-24(28(35)36)30-27(34)25(31-26(23)33)20-7-3-2-4-8-20/h5-6,9-14,20,23-25H,2-4,7-8,15-16H2,1H3,(H,29,32)(H,30,34)(H,31,33)(H,35,36)/t23-,24+,25+/m1/s1 |
| InChIKey | SUGLPJJYLNOPGC-DSITVLBTSA-N |
| XLogP | 2.72 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |