C34H42N4O8 — CID 10211474
2-[[3-[[(9S,12S)-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid (PubChem CID 10211474) has the molecular formula C34H42N4O8 and a molecular weight of 634.73 g/mol. Its IUPAC name is 2-[[3-[[(9S,12S)-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[[(9S,12S)-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10211474 |
| Molecular Formula | C34H42N4O8 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | 2-[[3-[[(9S,12S)-12-cyclohexyl-11,14-dioxo-2-oxa-10,13-diazatricyclo[15.2.2.13,7]docosa-1(19),3,5,7(22),17,20-hexaene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
| SMILES | CCCC(NC(=O)[C@@H]1Cc2cccc(c2)Oc2ccc(cc2)CCC(=O)N[C@@H](C2CCCCC2)C(=O)N1)C(=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C34H42N4O8/c1-2-7-26(31(42)34(45)35-20-29(40)41)36-32(43)27-19-22-8-6-11-25(18-22)46-24-15-12-21(13-16-24)14-17-28(39)38-30(33(44)37-27)23-9-4-3-5-10-23/h6,8,11-13,15-16,18,23,26-27,30H,2-5,7,9-10,14,17,19-20H2,1H3,(H,35,45)(H,36,43)(H,37,44)(H,38,39)(H,40,41)/t26?,27-,30-/m0/s1 |
| InChIKey | XVHACXPKULQSKY-GEULSNLOSA-N |
| XLogP | 2.57 |
| TPSA | 180.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|