C34H49N7O8 — CID 20810556
N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-3-cyclohexyl-2,5,8-trioxo-1,4,9-triazacyclotetradecane-14-carboxamide (PubChem CID 20810556) has the molecular formula C34H49N7O8 and a molecular weight of 683.81 g/mol. Its IUPAC name is N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-3-cyclohexyl-2,5,8-trioxo-1,4,9-triazacyclotetradecane-14-carboxamide.
| Compound Name | N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-3-cyclohexyl-2,5,8-trioxo-1,4,9-triazacyclotetradecane-14-carboxamide |
|---|---|
| PubChem CID | 20810556 |
| Molecular Formula | C34H49N7O8 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-3-cyclohexyl-2,5,8-trioxo-1,4,9-triazacyclotetradecane-14-carboxamide |
| SMILES | CCCC(NC(=O)C1CCCCNC(=O)CCC(=O)NC(C2CCCCC2)C(=O)N1)C(=O)C(=O)NCC(=O)NC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C34H49N7O8/c1-2-11-23(30(45)34(49)37-20-27(44)41-28(31(35)46)21-12-5-3-6-13-21)38-32(47)24-16-9-10-19-36-25(42)17-18-26(43)40-29(33(48)39-24)22-14-7-4-8-15-22/h3,5-6,12-13,22-24,28-29H,2,4,7-11,14-20H2,1H3,(H2,35,46)(H,36,42)(H,37,49)(H,38,47)(H,39,48)(H,40,43)(H,41,44) |
| InChIKey | ARVQTPVMVVSXNP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 234.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|