C37H55N7O8 — CID 20810552
N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-2-cyclohexyl-3,11,17-trioxo-1,4,10-triazacycloheptadecane-5-carboxamide (PubChem CID 20810552) has the molecular formula C37H55N7O8 and a molecular weight of 725.89 g/mol. Its IUPAC name is N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-2-cyclohexyl-3,11,17-trioxo-1,4,10-triazacycloheptadecane-5-carboxamide.
| Compound Name | N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-2-cyclohexyl-3,11,17-trioxo-1,4,10-triazacycloheptadecane-5-carboxamide |
|---|---|
| PubChem CID | 20810552 |
| Molecular Formula | C37H55N7O8 |
| Molecular Weight | 725.89 g/mol |
| Exact Mass | 725.41 |
| IUPAC Name | N-[1-[[2-[(2-amino-2-oxo-1-phenylethyl)amino]-2-oxoethyl]amino]-1,2-dioxohexan-3-yl]-2-cyclohexyl-3,11,17-trioxo-1,4,10-triazacycloheptadecane-5-carboxamide |
| SMILES | CCCC(NC(=O)C1CCCCNC(=O)CCCCCC(=O)NC(C2CCCCC2)C(=O)N1)C(=O)C(=O)NCC(=O)NC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C37H55N7O8/c1-2-14-26(33(48)37(52)40-23-30(47)44-31(34(38)49)24-15-6-3-7-16-24)41-35(50)27-19-12-13-22-39-28(45)20-10-5-11-21-29(46)43-32(36(51)42-27)25-17-8-4-9-18-25/h3,6-7,15-16,25-27,31-32H,2,4-5,8-14,17-23H2,1H3,(H2,38,49)(H,39,45)(H,40,52)(H,41,50)(H,42,51)(H,43,46)(H,44,47) |
| InChIKey | RENQKGAFOPGTLW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 234.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.89 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|