C36H45N5O8 — CID 142093371
2-[[2-[[3-[[(14Z)-6-methyl-5,8-dioxo-4,7-diazabicyclo[14.3.1]icosa-1(20),14,16,18-tetraene-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid (PubChem CID 142093371) has the molecular formula C36H45N5O8 and a molecular weight of 675.78 g/mol. Its IUPAC name is 2-[[2-[[3-[[(14Z)-6-methyl-5,8-dioxo-4,7-diazabicyclo[14.3.1]icosa-1(20),14,16,18-tetraene-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[2-[[3-[[(14Z)-6-methyl-5,8-dioxo-4,7-diazabicyclo[14.3.1]icosa-1(20),14,16,18-tetraene-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 142093371 |
| Molecular Formula | C36H45N5O8 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | 2-[[2-[[3-[[(14Z)-6-methyl-5,8-dioxo-4,7-diazabicyclo[14.3.1]icosa-1(20),14,16,18-tetraene-3-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetic acid |
| SMILES | CCCC(NC(=O)C1Cc2cccc(c2)/C=C\CCCCCC(=O)NC(C)C(=O)N1)C(=O)C(=O)NCC(=O)NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C36H45N5O8/c1-3-13-27(32(44)35(47)37-22-30(43)41-31(36(48)49)26-17-9-7-10-18-26)39-34(46)28-21-25-16-12-15-24(20-25)14-8-5-4-6-11-19-29(42)38-23(2)33(45)40-28/h7-10,12,14-18,20,23,27-28,31H,3-6,11,13,19,21-22H2,1-2H3,(H,37,47)(H,38,42)(H,39,46)(H,40,45)(H,41,43)(H,48,49)/b14-8- |
| InChIKey | URYQACQTSSPNOU-ZSOIEALJSA-N |
| XLogP | 2.11 |
| TPSA | 199.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|