C45H68N6O8 — CID 142093373
tert-butyl 2-[[2-[[3-[(6-cyclohexyl-5,8-dioxo-4,7,20-triazabicyclo[15.3.1]henicosa-1(21),19-diene-3-carbonyl)amino]-2-hydroxyhexanoyl]amino]acetyl]amino]-2-phenylacetate (PubChem CID 142093373) has the molecular formula C45H68N6O8 and a molecular weight of 821.07 g/mol. Its IUPAC name is tert-butyl 2-[[2-[[3-[(6-cyclohexyl-5,8-dioxo-4,7,20-triazabicyclo[15.3.1]henicosa-1(21),19-diene-3-carbonyl)amino]-2-hydroxyhexanoyl]amino]acetyl]amino]-2-phenylacetate.
| Compound Name | tert-butyl 2-[[2-[[3-[(6-cyclohexyl-5,8-dioxo-4,7,20-triazabicyclo[15.3.1]henicosa-1(21),19-diene-3-carbonyl)amino]-2-hydroxyhexanoyl]amino]acetyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 142093373 |
| Molecular Formula | C45H68N6O8 |
| Molecular Weight | 821.07 g/mol |
| Exact Mass | 820.51 |
| IUPAC Name | tert-butyl 2-[[2-[[3-[(6-cyclohexyl-5,8-dioxo-4,7,20-triazabicyclo[15.3.1]henicosa-1(21),19-diene-3-carbonyl)amino]-2-hydroxyhexanoyl]amino]acetyl]amino]-2-phenylacetate |
| SMILES | CCCC(NC(=O)C1CC2=CC(CC=N2)CCCCCCCCC(=O)NC(C2CCCCC2)C(=O)N1)C(O)C(=O)NCC(=O)NC(C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C45H68N6O8/c1-5-18-34(40(54)43(57)47-29-37(53)51-39(32-22-15-11-16-23-32)44(58)59-45(2,3)4)48-41(55)35-28-33-27-30(25-26-46-33)19-12-8-6-7-9-17-24-36(52)50-38(42(56)49-35)31-20-13-10-14-21-31/h11,15-16,22-23,26-27,30-31,34-35,38-40,54H,5-10,12-14,17-21,24-25,28-29H2,1-4H3,(H,47,57)(H,48,55)(H,49,56)(H,50,52)(H,51,53) |
| InChIKey | FICQJWATDLYJDO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 204.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.07 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |