C23H32BN3O6S — CID 90277124
CID 90277124 (PubChem CID 90277124) has the molecular formula C23H32BN3O6S and a molecular weight of 489.40 g/mol.
| Compound Name | CID 90277124 |
|---|---|
| PubChem CID | 90277124 |
| Molecular Formula | C23H32BN3O6S |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | — |
| SMILES | [B]O/C=N/[C@H]1Cc2ccc(cc2)OCCCCSC[C@@H](C(=O)OC)NC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C23H32BN3O6S/c1-15(2)20-22(29)26-19(23(30)31-3)13-34-11-5-4-10-32-17-8-6-16(7-9-17)12-18(21(28)27-20)25-14-33-24/h6-9,14-15,18-20H,4-5,10-13H2,1-3H3,(H,26,29)(H,27,28)/b25-14+/t18-,19-,20-/m0/s1 |
| InChIKey | YRJKPUUWXKKRTA-PLVPYGLSSA-N |
| XLogP | 1.43 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|