C31H41N3O6S — CID 24965843
benzyl N-[(9R,12S,15S)-9-formyl-15-methyl-12-(2-methylpropyl)-11,14-dioxo-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate (PubChem CID 24965843) has the molecular formula C31H41N3O6S and a molecular weight of 583.75 g/mol. Its IUPAC name is benzyl N-[(9R,12S,15S)-9-formyl-15-methyl-12-(2-methylpropyl)-11,14-dioxo-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate.
| Compound Name | benzyl N-[(9R,12S,15S)-9-formyl-15-methyl-12-(2-methylpropyl)-11,14-dioxo-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate |
|---|---|
| PubChem CID | 24965843 |
| Molecular Formula | C31H41N3O6S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | benzyl N-[(9R,12S,15S)-9-formyl-15-methyl-12-(2-methylpropyl)-11,14-dioxo-2-oxa-7-thia-10,13-diazabicyclo[15.2.2]henicosa-1(19),17,20-trien-15-yl]carbamate |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@](C)(NC(=O)OCc2ccccc2)Cc2ccc(cc2)OCCCCSC[C@@H](C=O)NC1=O |
| InChI | InChI=1S/C31H41N3O6S/c1-22(2)17-27-28(36)32-25(19-35)21-41-16-8-7-15-39-26-13-11-23(12-14-26)18-31(3,29(37)33-27)34-30(38)40-20-24-9-5-4-6-10-24/h4-6,9-14,19,22,25,27H,7-8,15-18,20-21H2,1-3H3,(H,32,36)(H,33,37)(H,34,38)/t25-,27+,31+/m1/s1 |
| InChIKey | GIRUMJLRWSNLTR-NFWIRQETSA-N |
| XLogP | 4.03 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|