C33H45NO5 — CID 58115108
benzyl 2-[(8R,11S,14R)-8-ethyl-11-(2-methylpropyl)-10,13-dioxo-2-oxa-12-azabicyclo[14.2.2]icosa-1(18),16,19-trien-14-yl]acetate (PubChem CID 58115108) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is benzyl 2-[(8R,11S,14R)-8-ethyl-11-(2-methylpropyl)-10,13-dioxo-2-oxa-12-azabicyclo[14.2.2]icosa-1(18),16,19-trien-14-yl]acetate.
| Compound Name | benzyl 2-[(8R,11S,14R)-8-ethyl-11-(2-methylpropyl)-10,13-dioxo-2-oxa-12-azabicyclo[14.2.2]icosa-1(18),16,19-trien-14-yl]acetate |
|---|---|
| PubChem CID | 58115108 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | benzyl 2-[(8R,11S,14R)-8-ethyl-11-(2-methylpropyl)-10,13-dioxo-2-oxa-12-azabicyclo[14.2.2]icosa-1(18),16,19-trien-14-yl]acetate |
| SMILES | CC[C@@H]1CCCCCOc2ccc(cc2)C[C@H](CC(=O)OCc2ccccc2)C(=O)N[C@@H](CC(C)C)C(=O)C1 |
| InChI | InChI=1S/C33H45NO5/c1-4-25-11-9-6-10-18-38-29-16-14-26(15-17-29)20-28(22-32(36)39-23-27-12-7-5-8-13-27)33(37)34-30(19-24(2)3)31(35)21-25/h5,7-8,12-17,24-25,28,30H,4,6,9-11,18-23H2,1-3H3,(H,34,37)/t25-,28-,30+/m1/s1 |
| InChIKey | HMRUIQDRSFRSNN-CZMKHNCBSA-N |
| XLogP | 6.45 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |