C34H40N2O6 — CID 10460704
(7S,8R,11S)-11-benzoyl-N-hydroxy-9-oxo-8-(4-phenylmethoxybutyl)-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide (PubChem CID 10460704) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is (7S,8R,11S)-11-benzoyl-N-hydroxy-9-oxo-8-(4-phenylmethoxybutyl)-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide.
| Compound Name | (7S,8R,11S)-11-benzoyl-N-hydroxy-9-oxo-8-(4-phenylmethoxybutyl)-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide |
|---|---|
| PubChem CID | 10460704 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | (7S,8R,11S)-11-benzoyl-N-hydroxy-9-oxo-8-(4-phenylmethoxybutyl)-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide |
| SMILES | O=C(c1ccccc1)[C@@H]1Cc2ccc(cc2)OCCCC[C@H](C(=O)NO)[C@@H](CCCCOCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C34H40N2O6/c37-32(27-13-5-2-6-14-27)31-23-25-17-19-28(20-18-25)42-22-10-8-16-30(34(39)36-40)29(33(38)35-31)15-7-9-21-41-24-26-11-3-1-4-12-26/h1-6,11-14,17-20,29-31,40H,7-10,15-16,21-24H2,(H,35,38)(H,36,39)/t29-,30+,31+/m1/s1 |
| InChIKey | BBTXFWMJLNETND-AYQJTBPPSA-N |
| XLogP | 5.28 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|