C35H44N2O7 — CID 102462661
(7S,8R,11S)-11-benzoyl-N-hydroxy-8-[3-(3,4,5-trimethoxyphenyl)propyl]-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide (PubChem CID 102462661) has the molecular formula C35H44N2O7 and a molecular weight of 604.74 g/mol. Its IUPAC name is (7S,8R,11S)-11-benzoyl-N-hydroxy-8-[3-(3,4,5-trimethoxyphenyl)propyl]-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide.
| Compound Name | (7S,8R,11S)-11-benzoyl-N-hydroxy-8-[3-(3,4,5-trimethoxyphenyl)propyl]-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide |
|---|---|
| PubChem CID | 102462661 |
| Molecular Formula | C35H44N2O7 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | (7S,8R,11S)-11-benzoyl-N-hydroxy-8-[3-(3,4,5-trimethoxyphenyl)propyl]-2-oxa-10-azabicyclo[11.2.2]heptadeca-1(15),13,16-triene-7-carboxamide |
| SMILES | COc1cc(CCC[C@H]2CN[C@H](C(=O)c3ccccc3)Cc3ccc(cc3)OCCCC[C@@H]2C(=O)NO)cc(OC)c1OC |
| InChI | InChI=1S/C35H44N2O7/c1-41-31-21-25(22-32(42-2)34(31)43-3)10-9-13-27-23-36-30(33(38)26-11-5-4-6-12-26)20-24-15-17-28(18-16-24)44-19-8-7-14-29(27)35(39)37-40/h4-6,11-12,15-18,21-22,27,29-30,36,40H,7-10,13-14,19-20,23H2,1-3H3,(H,37,39)/t27-,29-,30-/m0/s1 |
| InChIKey | QLVNJHVWHJGUJH-BKHJTQGXSA-N |
| XLogP | 5.42 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|