C21H25NO4 — CID 113095969
N-cyclopropyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide (PubChem CID 113095969) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide.
| Compound Name | N-cyclopropyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 113095969 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-cyclopropyl-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(CCN(C(=O)c2ccccc2)C2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25NO4/c1-24-18-13-15(14-19(25-2)20(18)26-3)11-12-22(17-9-10-17)21(23)16-7-5-4-6-8-16/h4-8,13-14,17H,9-12H2,1-3H3 |
| InChIKey | ASSYUHPGMYKQTJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |