C22H27NO5 — CID 113095976
N-cyclopropyl-2-methoxy-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide (PubChem CID 113095976) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-cyclopropyl-2-methoxy-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide.
| Compound Name | N-cyclopropyl-2-methoxy-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 113095976 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-cyclopropyl-2-methoxy-N-[2-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccccc1C(=O)N(CCc1cc(OC)c(OC)c(OC)c1)C1CC1 |
| InChI | InChI=1S/C22H27NO5/c1-25-18-8-6-5-7-17(18)22(24)23(16-9-10-16)12-11-15-13-19(26-2)21(28-4)20(14-15)27-3/h5-8,13-14,16H,9-12H2,1-4H3 |
| InChIKey | RUJRFLCSJVGPAH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |