C27H35NO7 — CID 70420718
3-(7-methyl-1H-inden-2-yl)-N-[3-(3,4,5-trimethoxyphenyl)propyl]propan-1-amine;oxalic acid (PubChem CID 70420718) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-(7-methyl-1H-inden-2-yl)-N-[3-(3,4,5-trimethoxyphenyl)propyl]propan-1-amine;oxalic acid.
| Compound Name | 3-(7-methyl-1H-inden-2-yl)-N-[3-(3,4,5-trimethoxyphenyl)propyl]propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 70420718 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 3-(7-methyl-1H-inden-2-yl)-N-[3-(3,4,5-trimethoxyphenyl)propyl]propan-1-amine;oxalic acid |
| SMILES | COc1cc(CCCNCCCC2=Cc3cccc(C)c3C2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H33NO3.C2H2O4/c1-18-8-5-11-21-14-19(15-22(18)21)9-6-12-26-13-7-10-20-16-23(27-2)25(29-4)24(17-20)28-3;3-1(4)2(5)6/h5,8,11,14,16-17,26H,6-7,9-10,12-13,15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | CSHXZBHDPNQMLW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|