C21H26FNO3 — CID 67531566
3-[3-[3-[2-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]phenyl]propanoic acid (PubChem CID 67531566) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is 3-[3-[3-[2-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[3-[2-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67531566 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 3-[3-[3-[2-(4-fluoro-3-methoxyphenyl)ethylamino]propyl]phenyl]propanoic acid |
| SMILES | COc1cc(CCNCCCc2cccc(CCC(=O)O)c2)ccc1F |
| InChI | InChI=1S/C21H26FNO3/c1-26-20-15-18(7-9-19(20)22)11-13-23-12-3-6-16-4-2-5-17(14-16)8-10-21(24)25/h2,4-5,7,9,14-15,23H,3,6,8,10-13H2,1H3,(H,24,25) |
| InChIKey | FGMNADBEWLGANM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|