C21H25F2NO3 — CID 67532802
3-[4-[3-(N-ethyl-4-fluoro-3-methoxyanilino)propyl]-2-fluorophenyl]propanoic acid (PubChem CID 67532802) has the molecular formula C21H25F2NO3 and a molecular weight of 377.43 g/mol. Its IUPAC name is 3-[4-[3-(N-ethyl-4-fluoro-3-methoxyanilino)propyl]-2-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-[3-(N-ethyl-4-fluoro-3-methoxyanilino)propyl]-2-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 67532802 |
| Molecular Formula | C21H25F2NO3 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3-[4-[3-(N-ethyl-4-fluoro-3-methoxyanilino)propyl]-2-fluorophenyl]propanoic acid |
| SMILES | CCN(CCCc1ccc(CCC(=O)O)c(F)c1)c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C21H25F2NO3/c1-3-24(17-9-10-18(22)20(14-17)27-2)12-4-5-15-6-7-16(19(23)13-15)8-11-21(25)26/h6-7,9-10,13-14H,3-5,8,11-12H2,1-2H3,(H,25,26) |
| InChIKey | ODYXGQQDPHXTAQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |