C22H36N2O4 — CID 59966088
(6S,7R,10R)-7-hexyl-6-[(hydroxyamino)oxymethyl]-10-methyl-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-trien-8-one (PubChem CID 59966088) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is (6S,7R,10R)-7-hexyl-6-[(hydroxyamino)oxymethyl]-10-methyl-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-trien-8-one.
| Compound Name | (6S,7R,10R)-7-hexyl-6-[(hydroxyamino)oxymethyl]-10-methyl-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-trien-8-one |
|---|---|
| PubChem CID | 59966088 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (6S,7R,10R)-7-hexyl-6-[(hydroxyamino)oxymethyl]-10-methyl-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-trien-8-one |
| SMILES | CCCCCC[C@H]1C(=O)N[C@H](C)Cc2ccc(cc2)OCCC[C@@H]1CONO |
| InChI | InChI=1S/C22H36N2O4/c1-3-4-5-6-9-21-19(16-28-24-26)8-7-14-27-20-12-10-18(11-13-20)15-17(2)23-22(21)25/h10-13,17,19,21,24,26H,3-9,14-16H2,1-2H3,(H,23,25)/t17-,19-,21-/m1/s1 |
| InChIKey | STWMNDHBJAQGHL-YFVAEKQCSA-N |
| XLogP | 4.02 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|