C23H36O3 — CID 143261517
trans-(2R,3S)-2-hexyl-3-[[4-(1-hydroxy-2-methylpropan-2-yl)phenoxy]methyl]cyclohexan-1-one (PubChem CID 143261517) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is trans-(2R,3S)-2-hexyl-3-[[4-(1-hydroxy-2-methylpropan-2-yl)phenoxy]methyl]cyclohexan-1-one.
| Compound Name | trans-(2R,3S)-2-hexyl-3-[[4-(1-hydroxy-2-methylpropan-2-yl)phenoxy]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 143261517 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | trans-(2R,3S)-2-hexyl-3-[[4-(1-hydroxy-2-methylpropan-2-yl)phenoxy]methyl]cyclohexan-1-one |
| SMILES | CCCCCC[C@H]1C(=O)CCC[C@@H]1COc1ccc(C(C)(C)CO)cc1 |
| InChI | InChI=1S/C23H36O3/c1-4-5-6-7-10-21-18(9-8-11-22(21)25)16-26-20-14-12-19(13-15-20)23(2,3)17-24/h12-15,18,21,24H,4-11,16-17H2,1-3H3/t18-,21-/m1/s1 |
| InChIKey | NBAYXXRIMRCMOY-WIYYLYMNSA-N |
| XLogP | 5.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|