C24H33NO5 — CID 123493726
methyl (7R,10S,13S)-13-methyl-10-(2-methylpropyl)-9,12-dioxo-2-oxa-11-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate (PubChem CID 123493726) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is methyl (7R,10S,13S)-13-methyl-10-(2-methylpropyl)-9,12-dioxo-2-oxa-11-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate.
| Compound Name | methyl (7R,10S,13S)-13-methyl-10-(2-methylpropyl)-9,12-dioxo-2-oxa-11-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 123493726 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | methyl (7R,10S,13S)-13-methyl-10-(2-methylpropyl)-9,12-dioxo-2-oxa-11-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=CCOc2ccc(cc2)C[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)C1 |
| InChI | InChI=1S/C24H33NO5/c1-16(2)13-21-22(26)15-19(24(28)29-4)7-5-6-12-30-20-10-8-18(9-11-20)14-17(3)23(27)25-21/h5-6,8-11,16-17,19,21H,7,12-15H2,1-4H3,(H,25,27)/t17-,19+,21-/m0/s1 |
| InChIKey | KXSBFIZWLZAVFB-DSKINZAPSA-N |
| XLogP | 3.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|