C24H35N6O6+ — CID 135985680
3-[(4Z,7S,10R,13S)-13-acetamido-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]propyl-(diaminomethylidene)azanium (PubChem CID 135985680) has the molecular formula C24H35N6O6+ and a molecular weight of 503.58 g/mol. Its IUPAC name is 3-[(4Z,7S,10R,13S)-13-acetamido-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]propyl-(diaminomethylidene)azanium.
| Compound Name | 3-[(4Z,7S,10R,13S)-13-acetamido-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]propyl-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 135985680 |
| Molecular Formula | C24H35N6O6+ |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 3-[(4Z,7S,10R,13S)-13-acetamido-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]propyl-(diaminomethylidene)azanium |
| SMILES | COC(=O)[C@@H]1C/C=C\COc2ccc(cc2)C[C@H](NC(C)=O)C(=O)N[C@H](CCC[NH+]=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C24H34N6O6/c1-15(31)28-20-14-16-8-10-17(11-9-16)36-13-4-3-6-19(23(34)35-2)30-21(32)18(29-22(20)33)7-5-12-27-24(25)26/h3-4,8-11,18-20H,5-7,12-14H2,1-2H3,(H,28,31)(H,29,33)(H,30,32)(H4,25,26,27)/p+1/b4-3-/t18-,19+,20+/m1/s1 |
| InChIKey | QKQRMLSKTKQGST-KCYZDWFNSA-O |
| XLogP | -2.65 |
| TPSA | 188.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|