C31H38N6O5 — CID 159056611
methyl (11R,14S)-8-acetamido-11-[3-(1-aminoethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate (PubChem CID 159056611) has the molecular formula C31H38N6O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is methyl (11R,14S)-8-acetamido-11-[3-(1-aminoethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate.
| Compound Name | methyl (11R,14S)-8-acetamido-11-[3-(1-aminoethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate |
|---|---|
| PubChem CID | 159056611 |
| Molecular Formula | C31H38N6O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | methyl (11R,14S)-8-acetamido-11-[3-(1-aminoethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=CCc2ccc3[nH]c4ccc(cc4c3c2)CC(NC(C)=O)C(=O)N[C@H](CCC/N=C(\C)N)C(=O)N1 |
| InChI | InChI=1S/C31H38N6O5/c1-18(32)33-14-6-9-26-29(39)37-27(31(41)42-3)8-5-4-7-20-10-12-24-22(15-20)23-16-21(11-13-25(23)35-24)17-28(30(40)36-26)34-19(2)38/h4-5,10-13,15-16,26-28,35H,6-9,14,17H2,1-3H3,(H2,32,33)(H,34,38)(H,36,40)(H,37,39)/t26-,27+,28?/m1/s1 |
| InChIKey | JXYAGLLETDQLRY-ANUFDVCNSA-N |
| XLogP | 2.17 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|