C30H38ClN5O5 — CID 89386352
methyl (11R,14S)-8-acetamido-11-[4-(chloroamino)butyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),19(23),20-hexaene-14-carboxylate (PubChem CID 89386352) has the molecular formula C30H38ClN5O5 and a molecular weight of 584.12 g/mol. Its IUPAC name is methyl (11R,14S)-8-acetamido-11-[4-(chloroamino)butyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),19(23),20-hexaene-14-carboxylate.
| Compound Name | methyl (11R,14S)-8-acetamido-11-[4-(chloroamino)butyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),19(23),20-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 89386352 |
| Molecular Formula | C30H38ClN5O5 |
| Molecular Weight | 584.12 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | methyl (11R,14S)-8-acetamido-11-[4-(chloroamino)butyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),19(23),20-hexaene-14-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCCc2ccc3[nH]c4ccc(cc4c3c2)CC(NC(C)=O)C(=O)N[C@H](CCCCNCl)C(=O)N1 |
| InChI | InChI=1S/C30H38ClN5O5/c1-18(37)33-27-17-20-11-13-24-22(16-20)21-15-19(10-12-23(21)34-24)7-3-4-9-26(30(40)41-2)36-28(38)25(35-29(27)39)8-5-6-14-32-31/h10-13,15-16,25-27,32,34H,3-9,14,17H2,1-2H3,(H,33,37)(H,35,39)(H,36,38)/t25-,26+,27?/m1/s1 |
| InChIKey | CKCGDFUECUZFRL-JZGSEIKYSA-N |
| XLogP | 3.15 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|