C31H39N5O5 — CID 58780223
methyl (11S,14S,16E)-8-acetamido-11-(4-aminobutyl)-24-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate (PubChem CID 58780223) has the molecular formula C31H39N5O5 and a molecular weight of 561.68 g/mol. Its IUPAC name is methyl (11S,14S,16E)-8-acetamido-11-(4-aminobutyl)-24-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate.
| Compound Name | methyl (11S,14S,16E)-8-acetamido-11-(4-aminobutyl)-24-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate |
|---|---|
| PubChem CID | 58780223 |
| Molecular Formula | C31H39N5O5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | methyl (11S,14S,16E)-8-acetamido-11-(4-aminobutyl)-24-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate |
| SMILES | COC(=O)[C@@H]1C/C=C/Cc2ccc3c(c2)c2cc(ccc2n3C)CC(NC(C)=O)C(=O)N[C@@H](CCCCN)C(=O)N1 |
| InChI | InChI=1S/C31H39N5O5/c1-19(37)33-26-18-21-12-14-28-23(17-21)22-16-20(11-13-27(22)36(28)2)8-4-5-10-25(31(40)41-3)35-29(38)24(34-30(26)39)9-6-7-15-32/h4-5,11-14,16-17,24-26H,6-10,15,18,32H2,1-3H3,(H,33,37)(H,34,39)(H,35,38)/b5-4+/t24-,25-,26?/m0/s1 |
| InChIKey | HZIQMYQNZKMUQZ-VZCSONOSSA-N |
| XLogP | 2.15 |
| TPSA | 144.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|