C23H30N4O4 — CID 58780252
methyl (3Z,6R,9S)-9-(4-aminobutyl)-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate (PubChem CID 58780252) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is methyl (3Z,6R,9S)-9-(4-aminobutyl)-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate.
| Compound Name | methyl (3Z,6R,9S)-9-(4-aminobutyl)-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate |
|---|---|
| PubChem CID | 58780252 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | methyl (3Z,6R,9S)-9-(4-aminobutyl)-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate |
| SMILES | COC(=O)[C@H]1C/C=C\Cn2cc(c3ccccc32)CC(=O)N[C@@H](CCCCN)C(=O)N1 |
| InChI | InChI=1S/C23H30N4O4/c1-31-23(30)19-10-5-7-13-27-15-16(17-8-2-3-11-20(17)27)14-21(28)25-18(22(29)26-19)9-4-6-12-24/h2-3,5,7-8,11,15,18-19H,4,6,9-10,12-14,24H2,1H3,(H,25,28)(H,26,29)/b7-5-/t18-,19+/m0/s1 |
| InChIKey | HRPQGSYJYBTOOU-OBPWJEEHSA-N |
| XLogP | 1.42 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|