C24H32N6O4 — CID 91477147
methyl (6R,9S)-9-[4-(diaminomethylideneamino)butyl]-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate (PubChem CID 91477147) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is methyl (6R,9S)-9-[4-(diaminomethylideneamino)butyl]-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate.
| Compound Name | methyl (6R,9S)-9-[4-(diaminomethylideneamino)butyl]-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate |
|---|---|
| PubChem CID | 91477147 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | methyl (6R,9S)-9-[4-(diaminomethylideneamino)butyl]-8,11-dioxo-1,7,10-triazatricyclo[11.6.1.014,19]icosa-3,13(20),14,16,18-pentaene-6-carboxylate |
| SMILES | COC(=O)[C@H]1CC=CCn2cc(c3ccccc32)CC(=O)N[C@@H](CCCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C24H32N6O4/c1-34-23(33)19-10-5-7-13-30-15-16(17-8-2-3-11-20(17)30)14-21(31)28-18(22(32)29-19)9-4-6-12-27-24(25)26/h2-3,5,7-8,11,15,18-19H,4,6,9-10,12-14H2,1H3,(H,28,31)(H,29,32)(H4,25,26,27)/t18-,19+/m0/s1 |
| InChIKey | JLBWYCZPJIOIFP-RBUKOAKNSA-N |
| XLogP | 0.73 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|