C30H37N7O5 — CID 173484622
methyl (11R)-8-acetamido-11-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate (PubChem CID 173484622) has the molecular formula C30H37N7O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is methyl (11R)-8-acetamido-11-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate.
| Compound Name | methyl (11R)-8-acetamido-11-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate |
|---|---|
| PubChem CID | 173484622 |
| Molecular Formula | C30H37N7O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | methyl (11R)-8-acetamido-11-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaene-14-carboxylate |
| SMILES | COC(=O)C1CC=CCc2ccc3[nH]c4ccc(cc4c3c2)CC(NC(C)=O)C(=O)N[C@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C30H37N7O5/c1-17(38)34-26-16-19-10-12-23-21(15-19)20-14-18(9-11-22(20)35-23)6-3-4-7-25(29(41)42-2)37-27(39)24(36-28(26)40)8-5-13-33-30(31)32/h3-4,9-12,14-15,24-26,35H,5-8,13,16H2,1-2H3,(H,34,38)(H,36,40)(H,37,39)(H4,31,32,33)/t24-,25?,26?/m1/s1 |
| InChIKey | YTOKNTPSENREIP-JDSVYEKJSA-N |
| XLogP | 1.07 |
| TPSA | 193.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|