C30H38ClN5O5 — CID 162004103
N-[(11S,14R)-11-(4-aminobutyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide;carbon dioxide;hydrochloride (PubChem CID 162004103) has the molecular formula C30H38ClN5O5 and a molecular weight of 584.12 g/mol. Its IUPAC name is N-[(11S,14R)-11-(4-aminobutyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide;carbon dioxide;hydrochloride.
| Compound Name | N-[(11S,14R)-11-(4-aminobutyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide;carbon dioxide;hydrochloride |
|---|---|
| PubChem CID | 162004103 |
| Molecular Formula | C30H38ClN5O5 |
| Molecular Weight | 584.12 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | N-[(11S,14R)-11-(4-aminobutyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide;carbon dioxide;hydrochloride |
| SMILES | CC(=O)NC1Cc2ccc3[nH]c4ccc(cc4c3c2)CC=CC[C@@H](C)NC(=O)[C@H](CCCCN)NC1=O.Cl.O=C=O |
| InChI | InChI=1S/C29H37N5O3.CO2.ClH/c1-18-7-3-4-8-20-10-12-24-22(15-20)23-16-21(11-13-25(23)33-24)17-27(32-19(2)35)29(37)34-26(28(36)31-18)9-5-6-14-30;2-1-3;/h3-4,10-13,15-16,18,26-27,33H,5-9,14,17,30H2,1-2H3,(H,31,36)(H,32,35)(H,34,37);;1H/t18-,26+,27?;;/m1../s1 |
| InChIKey | XNIHPQYODWOHGU-KGOFBXQISA-N |
| XLogP | 2.83 |
| TPSA | 163.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.12 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|