C32H39N5O5 — CID 160996172
carbon dioxide;N-[(11S,14R)-11-(5-iminohexyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide (PubChem CID 160996172) has the molecular formula C32H39N5O5 and a molecular weight of 573.69 g/mol. Its IUPAC name is carbon dioxide;N-[(11S,14R)-11-(5-iminohexyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide.
| Compound Name | carbon dioxide;N-[(11S,14R)-11-(5-iminohexyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide |
|---|---|
| PubChem CID | 160996172 |
| Molecular Formula | C32H39N5O5 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | carbon dioxide;N-[(11S,14R)-11-(5-iminohexyl)-14-methyl-9,12-dioxo-10,13,24-triazatetracyclo[17.3.1.12,6.13,22]pentacosa-1(22),2,4,6(25),16,19(23),20-heptaen-8-yl]acetamide |
| SMILES | O=C=O.[H]/N=C(\C)CCCC[C@@H]1NC(=O)C(NC(C)=O)Cc2ccc3[nH]c4ccc(cc4c3c2)CC=CC[C@@H](C)NC1=O |
| InChI | InChI=1S/C31H39N5O3.CO2/c1-19(32)8-4-7-11-28-30(38)33-20(2)9-5-6-10-22-12-14-26-24(16-22)25-17-23(13-15-27(25)35-26)18-29(31(39)36-28)34-21(3)37;2-1-3/h5-6,12-17,20,28-29,32,35H,4,7-11,18H2,1-3H3,(H,33,38)(H,34,37)(H,36,39);/b6-5?,32-19+;/t20-,28+,29?;/m1./s1 |
| InChIKey | TVGUEVIWSGVAKB-BXSSQWRCSA-N |
| XLogP | 3.88 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|