C25H35N5O6 — CID 158829927
methyl (7R,10R,13S)-13-acetamido-10-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-2-oxa-8-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate (PubChem CID 158829927) has the molecular formula C25H35N5O6 and a molecular weight of 501.58 g/mol. Its IUPAC name is methyl (7R,10R,13S)-13-acetamido-10-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-2-oxa-8-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate.
| Compound Name | methyl (7R,10R,13S)-13-acetamido-10-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-2-oxa-8-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 158829927 |
| Molecular Formula | C25H35N5O6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | methyl (7R,10R,13S)-13-acetamido-10-[3-(diaminomethylideneamino)propyl]-9,12-dioxo-2-oxa-8-azabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carboxylate |
| SMILES | COC(=O)[C@H]1CC=CCOc2ccc(cc2)C[C@H](NC(C)=O)C(=O)C[C@@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C25H35N5O6/c1-16(31)29-21-14-17-8-10-19(11-9-17)36-13-4-3-7-20(24(34)35-2)30-23(33)18(15-22(21)32)6-5-12-28-25(26)27/h3-4,8-11,18,20-21H,5-7,12-15H2,1-2H3,(H,29,31)(H,30,33)(H4,26,27,28)/t18-,20-,21+/m1/s1 |
| InChIKey | IWXLOARKEDXKSB-NRSPTQNISA-N |
| XLogP | 0.36 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|