C25H37N6O7+ — CID 87833662
amino-[4-[(4Z,7S,10S,13S)-13-(methoxycarbamoyl)-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]butylimino]-methylazanium (PubChem CID 87833662) has the molecular formula C25H37N6O7+ and a molecular weight of 533.61 g/mol. Its IUPAC name is amino-[4-[(4Z,7S,10S,13S)-13-(methoxycarbamoyl)-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]butylimino]-methylazanium.
| Compound Name | amino-[4-[(4Z,7S,10S,13S)-13-(methoxycarbamoyl)-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]butylimino]-methylazanium |
|---|---|
| PubChem CID | 87833662 |
| Molecular Formula | C25H37N6O7+ |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | amino-[4-[(4Z,7S,10S,13S)-13-(methoxycarbamoyl)-7-methoxycarbonyl-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraen-10-yl]butylimino]-methylazanium |
| SMILES | CONC(=O)[C@H]1Cc2ccc(cc2)OC/C=C\C[C@@H](C(=O)OC)NC(=O)[C@H](CCCC/N=[N+](\C)N)NC1=O |
| InChI | InChI=1S/C25H36N6O7/c1-31(26)27-14-6-4-8-20-24(34)29-21(25(35)36-2)9-5-7-15-38-18-12-10-17(11-13-18)16-19(22(32)28-20)23(33)30-37-3/h5,7,10-13,19-21H,4,6,8-9,14-16H2,1-3H3,(H4-,26,27,28,29,30,32,33,34)/p+1/b7-5-/t19-,20-,21-/m0/s1 |
| InChIKey | VPGDSYDCQUUJFW-VGHOEIBRSA-O |
| XLogP | 0.14 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|