C23H35N7O4S — CID 102011202
(4R,7S,10S)-10-butan-2-yl-7-[3-(diaminomethylideneamino)propyl]-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-4-carboxamide (PubChem CID 102011202) has the molecular formula C23H35N7O4S and a molecular weight of 505.65 g/mol. Its IUPAC name is (4R,7S,10S)-10-butan-2-yl-7-[3-(diaminomethylideneamino)propyl]-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-4-carboxamide.
| Compound Name | (4R,7S,10S)-10-butan-2-yl-7-[3-(diaminomethylideneamino)propyl]-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-4-carboxamide |
|---|---|
| PubChem CID | 102011202 |
| Molecular Formula | C23H35N7O4S |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (4R,7S,10S)-10-butan-2-yl-7-[3-(diaminomethylideneamino)propyl]-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-4-carboxamide |
| SMILES | CCC(C)[C@@H]1NC(=O)Cc2ccccc2SC[C@@H](C(N)=O)NC(=O)[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C23H35N7O4S/c1-3-13(2)19-22(34)28-15(8-6-10-27-23(25)26)21(33)29-16(20(24)32)12-35-17-9-5-4-7-14(17)11-18(31)30-19/h4-5,7,9,13,15-16,19H,3,6,8,10-12H2,1-2H3,(H2,24,32)(H,28,34)(H,29,33)(H,30,31)(H4,25,26,27)/t13?,15-,16-,19-/m0/s1 |
| InChIKey | KYPDMFNUQUONEF-RSOQJHINSA-N |
| XLogP | -0.63 |
| TPSA | 194.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|