C25H42N2O7 — CID 161437664
methyl (3S,9S,12S,16E)-3-methyl-6,9-bis(2-methylpropyl)-4,7,10-trioxo-1,14-dioxa-5,8-diazacyclooctadec-16-ene-12-carboxylate (PubChem CID 161437664) has the molecular formula C25H42N2O7 and a molecular weight of 482.62 g/mol. Its IUPAC name is methyl (3S,9S,12S,16E)-3-methyl-6,9-bis(2-methylpropyl)-4,7,10-trioxo-1,14-dioxa-5,8-diazacyclooctadec-16-ene-12-carboxylate.
| Compound Name | methyl (3S,9S,12S,16E)-3-methyl-6,9-bis(2-methylpropyl)-4,7,10-trioxo-1,14-dioxa-5,8-diazacyclooctadec-16-ene-12-carboxylate |
|---|---|
| PubChem CID | 161437664 |
| Molecular Formula | C25H42N2O7 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | methyl (3S,9S,12S,16E)-3-methyl-6,9-bis(2-methylpropyl)-4,7,10-trioxo-1,14-dioxa-5,8-diazacyclooctadec-16-ene-12-carboxylate |
| SMILES | COC(=O)[C@@H]1COC/C=C/COC[C@H](C)C(=O)NC(CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)C1 |
| InChI | InChI=1S/C25H42N2O7/c1-16(2)11-20-22(28)13-19(25(31)32-6)15-34-10-8-7-9-33-14-18(5)23(29)27-21(12-17(3)4)24(30)26-20/h7-8,16-21H,9-15H2,1-6H3,(H,26,30)(H,27,29)/b8-7+/t18-,19-,20-,21?/m0/s1 |
| InChIKey | VYWBREOBLRNVKQ-ADNFZPPSSA-N |
| XLogP | 2.04 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|