C25H27N3O6S2 — CID 177407514
methyl (11R)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate (PubChem CID 177407514) has the molecular formula C25H27N3O6S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is methyl (11R)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate.
| Compound Name | methyl (11R)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate |
|---|---|
| PubChem CID | 177407514 |
| Molecular Formula | C25H27N3O6S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | methyl (11R)-11-(9H-fluoren-9-ylmethoxycarbonylamino)-6,10-dioxo-1,2-dithia-5,9-diazacyclododecane-4-carboxylate |
| SMILES | COC(=O)C1CSSC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)NCCC(=O)N1 |
| InChI | InChI=1S/C25H27N3O6S2/c1-33-24(31)21-14-36-35-13-20(23(30)26-11-10-22(29)27-21)28-25(32)34-12-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,19-21H,10-14H2,1H3,(H,26,30)(H,27,29)(H,28,32)/t20-,21?/m0/s1 |
| InChIKey | QMEGQZBTGHXFGZ-BGERDNNASA-N |
| XLogP | 2.45 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|