C31H35N9O8 — CID 11614446
prop-2-enyl N-[(3S,7S,11S)-7-azido-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2,6,10,14-tetraoxo-1,5,9,13-tetrazacyclohexadec-3-yl]carbamate (PubChem CID 11614446) has the molecular formula C31H35N9O8 and a molecular weight of 661.68 g/mol. Its IUPAC name is prop-2-enyl N-[(3S,7S,11S)-7-azido-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2,6,10,14-tetraoxo-1,5,9,13-tetrazacyclohexadec-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[(3S,7S,11S)-7-azido-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2,6,10,14-tetraoxo-1,5,9,13-tetrazacyclohexadec-3-yl]carbamate |
|---|---|
| PubChem CID | 11614446 |
| Molecular Formula | C31H35N9O8 |
| Molecular Weight | 661.68 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | prop-2-enyl N-[(3S,7S,11S)-7-azido-11-(9H-fluoren-9-ylmethoxycarbonylamino)-2,6,10,14-tetraoxo-1,5,9,13-tetrazacyclohexadec-3-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H]1CNC(=O)[C@@H](N=[N+]=[N-])CNC(=O)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)CNC(=O)CCNC1=O |
| InChI | InChI=1S/C31H35N9O8/c1-2-13-47-30(45)37-24-15-35-29(44)25(39-40-32)16-36-28(43)23(14-34-26(41)11-12-33-27(24)42)38-31(46)48-17-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22/h2-10,22-25H,1,11-17H2,(H,33,42)(H,34,41)(H,35,44)(H,36,43)(H,37,45)(H,38,46)/t23-,24-,25-/m0/s1 |
| InChIKey | LVFSTRDDIDZXSW-SDHOMARFSA-N |
| XLogP | 0.72 |
| TPSA | 241.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.68 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|