C19H15NO5 — CID 102482315
9H-fluoren-9-ylmethyl N-[(3R)-2,5-dioxooxolan-3-yl]carbamate (PubChem CID 102482315) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(3R)-2,5-dioxooxolan-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(3R)-2,5-dioxooxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 102482315 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(3R)-2,5-dioxooxolan-3-yl]carbamate |
| SMILES | O=C1C[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O1 |
| InChI | InChI=1S/C19H15NO5/c21-17-9-16(18(22)25-17)20-19(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H,20,23)/t16-/m1/s1 |
| InChIKey | BOZNBBMVUCBOHK-MRXNPFEDSA-N |
| XLogP | 2.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|