C19H16N2O4 — CID 134872049
9H-fluoren-9-ylmethyl N-(5-imino-2-oxooxolan-3-yl)carbamate (PubChem CID 134872049) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(5-imino-2-oxooxolan-3-yl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(5-imino-2-oxooxolan-3-yl)carbamate |
|---|---|
| PubChem CID | 134872049 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(5-imino-2-oxooxolan-3-yl)carbamate |
| SMILES | [H]/N=C1/CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O1 |
| InChI | InChI=1S/C19H16N2O4/c20-17-9-16(18(22)25-17)21-19(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20H,9-10H2,(H,21,23)/b20-17- |
| InChIKey | VELFCLBBZOXOTE-JZJYNLBNSA-N |
| XLogP | 2.82 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|