C20H19NO4 — CID 57457757
9H-fluoren-9-ylmethyl N-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]carbamate (PubChem CID 57457757) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 57457757 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R,3R)-2-methyl-4-oxooxolan-3-yl]carbamate |
| SMILES | C[C@H]1OCC(=O)[C@@H]1NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H19NO4/c1-12-19(18(22)11-24-12)21-20(23)25-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17,19H,10-11H2,1H3,(H,21,23)/t12-,19-/m1/s1 |
| InChIKey | DEXXJHNWQYMDSZ-CWTRNNRKSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |